C27H20I3O3S+ — CID 153464203
[4-[3-oxo-3-(2,4,6-triiodophenoxy)propoxy]phenyl]-diphenylsulfanium (PubChem CID 153464203) has the molecular formula C27H20I3O3S+ and a molecular weight of 805.23 g/mol. Its IUPAC name is [4-[3-oxo-3-(2,4,6-triiodophenoxy)propoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[3-oxo-3-(2,4,6-triiodophenoxy)propoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 153464203 |
| Molecular Formula | C27H20I3O3S+ |
| Molecular Weight | 805.23 g/mol |
| Exact Mass | 804.83 |
| IUPAC Name | [4-[3-oxo-3-(2,4,6-triiodophenoxy)propoxy]phenyl]-diphenylsulfanium |
| SMILES | O=C(CCOc1ccc([S+](c2ccccc2)c2ccccc2)cc1)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C27H20I3O3S/c28-19-17-24(29)27(25(30)18-19)33-26(31)15-16-32-20-11-13-23(14-12-20)34(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,17-18H,15-16H2/q+1 |
| InChIKey | LXIZNDASPZNUDO-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.23 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|