C33H30I3N2O4S+ — CID 153464190
[4-[2-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxypropan-2-yl]phenyl]-diphenylsulfanium (PubChem CID 153464190) has the molecular formula C33H30I3N2O4S+ and a molecular weight of 931.39 g/mol. Its IUPAC name is [4-[2-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxypropan-2-yl]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxypropan-2-yl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 153464190 |
| Molecular Formula | C33H30I3N2O4S+ |
| Molecular Weight | 931.39 g/mol |
| Exact Mass | 930.91 |
| IUPAC Name | [4-[2-[3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxypropan-2-yl]phenyl]-diphenylsulfanium |
| SMILES | CC(=O)Nc1c(I)c(C(=O)OC(C)(C)c2ccc([S+](c3ccccc3)c3ccccc3)cc2)c(I)c(N(C)C(C)=O)c1I |
| InChI | InChI=1S/C33H29I3N2O4S/c1-20(39)37-30-27(34)26(28(35)31(29(30)36)38(5)21(2)40)32(41)42-33(3,4)22-16-18-25(19-17-22)43(23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19H,1-5H3/p+1 |
| InChIKey | VFRYGNHPODSPLX-UHFFFAOYSA-O |
| XLogP | 8.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.39 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|