About [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium
[4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium (PubChem CID 148949550) has the molecular formula C28H23I2O3S+
and a molecular weight of 693.36 g/mol. Its IUPAC name is [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium.
Molecular Properties
| Compound Name | [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium |
| PubChem CID | 148949550 |
| Molecular Formula | C28H23I2O3S+ |
| Molecular Weight | 693.36 g/mol |
| Exact Mass | 692.95 |
| IUPAC Name | [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(OC(=O)c1c(I)ccc(I)c1O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22I2O3S/c1-28(2,33-27(32)25-23(29)17-18-24(30)26(25)31)19-13-15-22(16-14-19)34(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-18H,1-2H3/p+1 |
| InChIKey | PPOXUOCQRRGWMW-UHFFFAOYSA-O |
| XLogP | 7.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 693.36 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium?
The IUPAC name of [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium (CID 148949550) is [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium.
What is the SMILES notation for [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium?
The canonical SMILES for [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium is CC(C)(OC(=O)c1c(I)ccc(I)c1O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium?
The InChIKey is PPOXUOCQRRGWMW-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H22I2O3S/c1-28(2,33-27(32)25-23(29)17-18-24(30)26(25)31)19-13-15-22(16-14-19)34(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-18H,1-2H3/p+1.
What are the key properties of [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium?
[4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium has a molecular weight of 693.36 g/mol, XLogP of 7.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2-hydroxy-3,6-diiodobenzoyl)oxypropan-2-yl]phenyl]-diphenylsulfanium is sourced from PubChem (CID 148949550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).