C32H30NO3S+ — CID 169017607
[4-[4-[2-(4-cyanophenyl)propan-2-yloxy]-4-oxobutoxy]phenyl]-diphenylsulfanium (PubChem CID 169017607) has the molecular formula C32H30NO3S+ and a molecular weight of 508.66 g/mol. Its IUPAC name is [4-[4-[2-(4-cyanophenyl)propan-2-yloxy]-4-oxobutoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[4-[2-(4-cyanophenyl)propan-2-yloxy]-4-oxobutoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017607 |
| Molecular Formula | C32H30NO3S+ |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | [4-[4-[2-(4-cyanophenyl)propan-2-yloxy]-4-oxobutoxy]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(OC(=O)CCCOc1ccc([S+](c2ccccc2)c2ccccc2)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C32H30NO3S/c1-32(2,26-17-15-25(24-33)16-18-26)36-31(34)14-9-23-35-27-19-21-30(22-20-27)37(28-10-5-3-6-11-28)29-12-7-4-8-13-29/h3-8,10-13,15-22H,9,14,23H2,1-2H3/q+1 |
| InChIKey | MXVDVGXTSHPGDW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|