C32H28I3O4S+ — CID 153464125
diphenyl-[4-[2-[4-(2,3,6-triiodobenzoyl)oxybutanoyloxy]propan-2-yl]phenyl]sulfanium (PubChem CID 153464125) has the molecular formula C32H28I3O4S+ and a molecular weight of 889.35 g/mol. Its IUPAC name is diphenyl-[4-[2-[4-(2,3,6-triiodobenzoyl)oxybutanoyloxy]propan-2-yl]phenyl]sulfanium.
| Compound Name | diphenyl-[4-[2-[4-(2,3,6-triiodobenzoyl)oxybutanoyloxy]propan-2-yl]phenyl]sulfanium |
|---|---|
| PubChem CID | 153464125 |
| Molecular Formula | C32H28I3O4S+ |
| Molecular Weight | 889.35 g/mol |
| Exact Mass | 888.88 |
| IUPAC Name | diphenyl-[4-[2-[4-(2,3,6-triiodobenzoyl)oxybutanoyloxy]propan-2-yl]phenyl]sulfanium |
| SMILES | CC(C)(OC(=O)CCCOC(=O)c1c(I)ccc(I)c1I)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28I3O4S/c1-32(2,39-28(36)14-9-21-38-31(37)29-26(33)19-20-27(34)30(29)35)22-15-17-25(18-16-22)40(23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-8,10-13,15-20H,9,14,21H2,1-2H3/q+1 |
| InChIKey | JALVGKZYZLDKGD-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.35 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|