About diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium
diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium (PubChem CID 153464119) has the molecular formula C25H16I3O2S+
and a molecular weight of 761.18 g/mol. Its IUPAC name is diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium.
Molecular Properties
| Compound Name | diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium |
| PubChem CID | 153464119 |
| Molecular Formula | C25H16I3O2S+ |
| Molecular Weight | 761.18 g/mol |
| Exact Mass | 760.80 |
| IUPAC Name | diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium |
| SMILES | O=C(Oc1ccccc1[S+](c1ccccc1)c1ccccc1)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C25H16I3O2S/c26-19-15-16-20(27)24(28)23(19)25(29)30-21-13-7-8-14-22(21)31(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-16H/q+1 |
| InChIKey | CFKRJDYLGIAOEE-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 761.18 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium?
The IUPAC name of diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium (CID 153464119) is diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium.
What is the SMILES notation for diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium?
The canonical SMILES for diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium is O=C(Oc1ccccc1[S+](c1ccccc1)c1ccccc1)c1c(I)ccc(I)c1I.
What is the InChIKey of diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium?
The InChIKey is CFKRJDYLGIAOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16I3O2S/c26-19-15-16-20(27)24(28)23(19)25(29)30-21-13-7-8-14-22(21)31(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-16H/q+1.
What are the key properties of diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium?
diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium has a molecular weight of 761.18 g/mol, XLogP of 7.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[2-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium is sourced from PubChem (CID 153464119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).