C17H9I3O3 — CID 146201309
(8-hydroxynaphthalen-1-yl) 2,3,6-triiodobenzoate (PubChem CID 146201309) has the molecular formula C17H9I3O3 and a molecular weight of 641.97 g/mol. Its IUPAC name is (8-hydroxynaphthalen-1-yl) 2,3,6-triiodobenzoate.
| Compound Name | (8-hydroxynaphthalen-1-yl) 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 146201309 |
| Molecular Formula | C17H9I3O3 |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 641.77 |
| IUPAC Name | (8-hydroxynaphthalen-1-yl) 2,3,6-triiodobenzoate |
| SMILES | O=C(Oc1cccc2cccc(O)c12)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C17H9I3O3/c18-10-7-8-11(19)16(20)15(10)17(22)23-13-6-2-4-9-3-1-5-12(21)14(9)13/h1-8,21H |
| InChIKey | PHVXIVGHAKRCPV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|