C13H7I3O5 — CID 146201330
(2,4,5-trihydroxyphenyl) 2,3,6-triiodobenzoate (PubChem CID 146201330) has the molecular formula C13H7I3O5 and a molecular weight of 623.91 g/mol. Its IUPAC name is (2,4,5-trihydroxyphenyl) 2,3,6-triiodobenzoate.
| Compound Name | (2,4,5-trihydroxyphenyl) 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 146201330 |
| Molecular Formula | C13H7I3O5 |
| Molecular Weight | 623.91 g/mol |
| Exact Mass | 623.74 |
| IUPAC Name | (2,4,5-trihydroxyphenyl) 2,3,6-triiodobenzoate |
| SMILES | O=C(Oc1cc(O)c(O)cc1O)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C13H7I3O5/c14-5-1-2-6(15)12(16)11(5)13(20)21-10-4-8(18)7(17)3-9(10)19/h1-4,17-19H |
| InChIKey | PFGNEMGDQFGJET-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|