C27H28BrO5S+ — CID 156683995
2-[2-[2-(4-dibenzothiophen-5-ium-5-ylphenoxy)ethoxy]ethoxy]ethyl 2-bromopropanoate (PubChem CID 156683995) has the molecular formula C27H28BrO5S+ and a molecular weight of 544.49 g/mol. Its IUPAC name is 2-[2-[2-(4-dibenzothiophen-5-ium-5-ylphenoxy)ethoxy]ethoxy]ethyl 2-bromopropanoate.
| Compound Name | 2-[2-[2-(4-dibenzothiophen-5-ium-5-ylphenoxy)ethoxy]ethoxy]ethyl 2-bromopropanoate |
|---|---|
| PubChem CID | 156683995 |
| Molecular Formula | C27H28BrO5S+ |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | 2-[2-[2-(4-dibenzothiophen-5-ium-5-ylphenoxy)ethoxy]ethoxy]ethyl 2-bromopropanoate |
| SMILES | CC(Br)C(=O)OCCOCCOCCOc1ccc(-[s+]2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C27H28BrO5S/c1-20(28)27(29)33-19-17-31-15-14-30-16-18-32-21-10-12-22(13-11-21)34-25-8-4-2-6-23(25)24-7-3-5-9-26(24)34/h2-13,20H,14-19H2,1H3/q+1 |
| InChIKey | HEMXGBBOLCAXCU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|