About trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate
trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate (PubChem CID 91697076) has the molecular formula C17H27I3O3Si2
and a molecular weight of 716.28 g/mol. Its IUPAC name is trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate.
Molecular Properties
| Compound Name | trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate |
| PubChem CID | 91697076 |
| Molecular Formula | C17H27I3O3Si2 |
| Molecular Weight | 716.28 g/mol |
| Exact Mass | 715.86 |
| IUPAC Name | trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate |
| SMILES | CCC(Cc1c(I)cc(I)c(O[Si](C)(C)C)c1I)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H27I3O3Si2/c1-8-11(17(21)23-25(5,6)7)9-12-13(18)10-14(19)16(15(12)20)22-24(2,3)4/h10-11H,8-9H2,1-7H3 |
| InChIKey | DFSNJZUFBBLRNT-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 716.28 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate?
The IUPAC name of trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate (CID 91697076) is trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate.
What is the SMILES notation for trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate?
The canonical SMILES for trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate is CCC(Cc1c(I)cc(I)c(O[Si](C)(C)C)c1I)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate?
The InChIKey is DFSNJZUFBBLRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27I3O3Si2/c1-8-11(17(21)23-25(5,6)7)9-12-13(18)10-14(19)16(15(12)20)22-24(2,3)4/h10-11H,8-9H2,1-7H3.
What are the key properties of trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate?
trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate has a molecular weight of 716.28 g/mol, XLogP of 6.66, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2-[(2,4,6-triiodo-3-trimethylsilyloxyphenyl)methyl]butanoate is sourced from PubChem (CID 91697076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).