C18H34INO3Si3 — CID 91735334
trimethylsilyl 3-(3-iodo-4-trimethylsilyloxyphenyl)-2-(trimethylsilylamino)propanoate (PubChem CID 91735334) has the molecular formula C18H34INO3Si3 and a molecular weight of 523.64 g/mol. Its IUPAC name is trimethylsilyl 3-(3-iodo-4-trimethylsilyloxyphenyl)-2-(trimethylsilylamino)propanoate.
| Compound Name | trimethylsilyl 3-(3-iodo-4-trimethylsilyloxyphenyl)-2-(trimethylsilylamino)propanoate |
|---|---|
| PubChem CID | 91735334 |
| Molecular Formula | C18H34INO3Si3 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | trimethylsilyl 3-(3-iodo-4-trimethylsilyloxyphenyl)-2-(trimethylsilylamino)propanoate |
| SMILES | C[Si](C)(C)NC(Cc1ccc(O[Si](C)(C)C)c(I)c1)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C18H34INO3Si3/c1-24(2,3)20-16(18(21)23-26(7,8)9)13-14-10-11-17(15(19)12-14)22-25(4,5)6/h10-12,16,20H,13H2,1-9H3 |
| InChIKey | FMANXQITCFUTIG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|