C18H45N3O3Si4 — CID 91696357
trimethylsilyl 2-(trimethylsilylamino)-5-[trimethylsilyl(trimethylsilylcarbamoyl)amino]pentanoate (PubChem CID 91696357) has the molecular formula C18H45N3O3Si4 and a molecular weight of 463.92 g/mol. Its IUPAC name is trimethylsilyl 2-(trimethylsilylamino)-5-[trimethylsilyl(trimethylsilylcarbamoyl)amino]pentanoate.
| Compound Name | trimethylsilyl 2-(trimethylsilylamino)-5-[trimethylsilyl(trimethylsilylcarbamoyl)amino]pentanoate |
|---|---|
| PubChem CID | 91696357 |
| Molecular Formula | C18H45N3O3Si4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | trimethylsilyl 2-(trimethylsilylamino)-5-[trimethylsilyl(trimethylsilylcarbamoyl)amino]pentanoate |
| SMILES | C[Si](C)(C)NC(=O)N(CCCC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H45N3O3Si4/c1-25(2,3)19-16(17(22)24-28(10,11)12)14-13-15-21(27(7,8)9)18(23)20-26(4,5)6/h16,19H,13-15H2,1-12H3,(H,20,23) |
| InChIKey | DPSWRKSWNLPBJF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|