C16H27NO4Si2 — CID 612631
trimethylsilyl 3-(1,3-benzodioxol-5-yl)-2-(trimethylsilylamino)propanoate (PubChem CID 612631) has the molecular formula C16H27NO4Si2 and a molecular weight of 353.57 g/mol. Its IUPAC name is trimethylsilyl 3-(1,3-benzodioxol-5-yl)-2-(trimethylsilylamino)propanoate.
| Compound Name | trimethylsilyl 3-(1,3-benzodioxol-5-yl)-2-(trimethylsilylamino)propanoate |
|---|---|
| PubChem CID | 612631 |
| Molecular Formula | C16H27NO4Si2 |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | trimethylsilyl 3-(1,3-benzodioxol-5-yl)-2-(trimethylsilylamino)propanoate |
| SMILES | C[Si](C)(C)NC(Cc1ccc2c(c1)OCO2)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H27NO4Si2/c1-22(2,3)17-13(16(18)21-23(4,5)6)9-12-7-8-14-15(10-12)20-11-19-14/h7-8,10,13,17H,9,11H2,1-6H3 |
| InChIKey | CJNGWEDYSVDABS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|