C19H46N2O4SSi4 — CID 530161
trimethylsilyl 4-[3-oxo-2-(trimethylsilylamino)-3-trimethylsilyloxypropyl]sulfanyl-2-(trimethylsilylamino)butanoate (PubChem CID 530161) has the molecular formula C19H46N2O4SSi4 and a molecular weight of 511.00 g/mol. Its IUPAC name is trimethylsilyl 4-[3-oxo-2-(trimethylsilylamino)-3-trimethylsilyloxypropyl]sulfanyl-2-(trimethylsilylamino)butanoate.
| Compound Name | trimethylsilyl 4-[3-oxo-2-(trimethylsilylamino)-3-trimethylsilyloxypropyl]sulfanyl-2-(trimethylsilylamino)butanoate |
|---|---|
| PubChem CID | 530161 |
| Molecular Formula | C19H46N2O4SSi4 |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | trimethylsilyl 4-[3-oxo-2-(trimethylsilylamino)-3-trimethylsilyloxypropyl]sulfanyl-2-(trimethylsilylamino)butanoate |
| SMILES | C[Si](C)(C)NC(CCSCC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C19H46N2O4SSi4/c1-27(2,3)20-16(18(22)24-29(7,8)9)13-14-26-15-17(21-28(4,5)6)19(23)25-30(10,11)12/h16-17,20-21H,13-15H2,1-12H3 |
| InChIKey | UCHYCIWAEYBTEB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|