C20H48N2O4S2Si4 — CID 552899
trimethylsilyl 4-[[4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutyl]disulfanyl]-2-(trimethylsilylamino)butanoate (PubChem CID 552899) has the molecular formula C20H48N2O4S2Si4 and a molecular weight of 557.09 g/mol. Its IUPAC name is trimethylsilyl 4-[[4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutyl]disulfanyl]-2-(trimethylsilylamino)butanoate.
| Compound Name | trimethylsilyl 4-[[4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutyl]disulfanyl]-2-(trimethylsilylamino)butanoate |
|---|---|
| PubChem CID | 552899 |
| Molecular Formula | C20H48N2O4S2Si4 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | trimethylsilyl 4-[[4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutyl]disulfanyl]-2-(trimethylsilylamino)butanoate |
| SMILES | C[Si](C)(C)NC(CCSSCCC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C20H48N2O4S2Si4/c1-29(2,3)21-17(19(23)25-31(7,8)9)13-15-27-28-16-14-18(22-30(4,5)6)20(24)26-32(10,11)12/h17-18,21-22H,13-16H2,1-12H3 |
| InChIKey | VVODJOVRLCDBOE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|