C16H41N2O5SSi2+ — CID 131714071
4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutane-1-sulfonic acid;triethylazanium (PubChem CID 131714071) has the molecular formula C16H41N2O5SSi2+ and a molecular weight of 429.75 g/mol. Its IUPAC name is 4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutane-1-sulfonic acid;triethylazanium.
| Compound Name | 4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutane-1-sulfonic acid;triethylazanium |
|---|---|
| PubChem CID | 131714071 |
| Molecular Formula | C16H41N2O5SSi2+ |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 4-oxo-3-(trimethylsilylamino)-4-trimethylsilyloxybutane-1-sulfonic acid;triethylazanium |
| SMILES | CC[NH+](CC)CC.C[Si](C)(C)NC(CCS(=O)(=O)O)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C10H25NO5SSi2.C6H15N/c1-18(2,3)11-9(7-8-17(13,14)15)10(12)16-19(4,5)6;1-4-7(5-2)6-3/h9,11H,7-8H2,1-6H3,(H,13,14,15);4-6H2,1-3H3/p+1 |
| InChIKey | KOXWLLJYEYIGME-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|