C10H20N2O6S2Se — CID 141025878
[(2S)-2-(hydroxyamino)-4-methylsulfanylbutanoyl]oxyselanyl (2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate (PubChem CID 141025878) has the molecular formula C10H20N2O6S2Se and a molecular weight of 407.37 g/mol. Its IUPAC name is [(2S)-2-(hydroxyamino)-4-methylsulfanylbutanoyl]oxyselanyl (2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate.
| Compound Name | [(2S)-2-(hydroxyamino)-4-methylsulfanylbutanoyl]oxyselanyl (2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 141025878 |
| Molecular Formula | C10H20N2O6S2Se |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | [(2S)-2-(hydroxyamino)-4-methylsulfanylbutanoyl]oxyselanyl (2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NO)C(=O)O[Se]OC(=O)[C@H](CCSC)NO |
| InChI | InChI=1S/C10H20N2O6S2Se/c1-19-5-3-7(11-15)9(13)17-21-18-10(14)8(12-16)4-6-20-2/h7-8,11-12,15-16H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | YZHSESQTIIPYNE-YUMQZZPRSA-N |
| XLogP | -0.19 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|