C8H18N2OS — CID 159990263
(3S)-3-(2,2-dimethylhydrazinyl)-5-methylsulfanylpentan-2-one (PubChem CID 159990263) has the molecular formula C8H18N2OS and a molecular weight of 190.31 g/mol. Its IUPAC name is (3S)-3-(2,2-dimethylhydrazinyl)-5-methylsulfanylpentan-2-one.
| Compound Name | (3S)-3-(2,2-dimethylhydrazinyl)-5-methylsulfanylpentan-2-one |
|---|---|
| PubChem CID | 159990263 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (3S)-3-(2,2-dimethylhydrazinyl)-5-methylsulfanylpentan-2-one |
| SMILES | CSCC[C@H](NN(C)C)C(C)=O |
| InChI | InChI=1S/C8H18N2OS/c1-7(11)8(5-6-12-4)9-10(2)3/h8-9H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | OGWALMKZICWGTQ-QMMMGPOBSA-N |
| XLogP | 0.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|