C11H21NO3S — CID 122432676
2-methylpropyl N-(1-methylsulfanyl-4-oxopentan-3-yl)carbamate (PubChem CID 122432676) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-methylpropyl N-(1-methylsulfanyl-4-oxopentan-3-yl)carbamate.
| Compound Name | 2-methylpropyl N-(1-methylsulfanyl-4-oxopentan-3-yl)carbamate |
|---|---|
| PubChem CID | 122432676 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-methylpropyl N-(1-methylsulfanyl-4-oxopentan-3-yl)carbamate |
| SMILES | CSCCC(NC(=O)OCC(C)C)C(C)=O |
| InChI | InChI=1S/C11H21NO3S/c1-8(2)7-15-11(14)12-10(9(3)13)5-6-16-4/h8,10H,5-7H2,1-4H3,(H,12,14) |
| InChIKey | YPTJQYPYBRPSCI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |