C15H27NO3S — CID 158769923
N-(5-methyl-2-oxohexan-3-yl)-2-(2-methylsulfanylethyl)-4-oxopentanamide (PubChem CID 158769923) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is N-(5-methyl-2-oxohexan-3-yl)-2-(2-methylsulfanylethyl)-4-oxopentanamide.
| Compound Name | N-(5-methyl-2-oxohexan-3-yl)-2-(2-methylsulfanylethyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 158769923 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-(5-methyl-2-oxohexan-3-yl)-2-(2-methylsulfanylethyl)-4-oxopentanamide |
| SMILES | CSCCC(CC(C)=O)C(=O)NC(CC(C)C)C(C)=O |
| InChI | InChI=1S/C15H27NO3S/c1-10(2)8-14(12(4)18)16-15(19)13(6-7-20-5)9-11(3)17/h10,13-14H,6-9H2,1-5H3,(H,16,19) |
| InChIKey | GKVXKERTBIOXHG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |