C27H40N2O5S — CID 159672009
2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxo-N-(3-oxobutyl)octanamide (PubChem CID 159672009) has the molecular formula C27H40N2O5S and a molecular weight of 504.69 g/mol. Its IUPAC name is 2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxo-N-(3-oxobutyl)octanamide.
| Compound Name | 2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxo-N-(3-oxobutyl)octanamide |
|---|---|
| PubChem CID | 159672009 |
| Molecular Formula | C27H40N2O5S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxo-N-(3-oxobutyl)octanamide |
| SMILES | CSCCC(CC=O)C(=O)NC(CC(C)C)C(=O)CC(Cc1ccccc1)C(=O)NCCC(C)=O |
| InChI | InChI=1S/C27H40N2O5S/c1-19(2)16-24(29-27(34)22(11-14-30)12-15-35-4)25(32)18-23(17-21-8-6-5-7-9-21)26(33)28-13-10-20(3)31/h5-9,14,19,22-24H,10-13,15-18H2,1-4H3,(H,28,33)(H,29,34) |
| InChIKey | BTZPGVQDBGWBBL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|