C30H47N3O5S — CID 159672010
N-(5-amino-6-oxoheptyl)-2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxooctanamide (PubChem CID 159672010) has the molecular formula C30H47N3O5S and a molecular weight of 561.79 g/mol. Its IUPAC name is N-(5-amino-6-oxoheptyl)-2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxooctanamide.
| Compound Name | N-(5-amino-6-oxoheptyl)-2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxooctanamide |
|---|---|
| PubChem CID | 159672010 |
| Molecular Formula | C30H47N3O5S |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | N-(5-amino-6-oxoheptyl)-2-benzyl-7-methyl-5-[[2-(2-methylsulfanylethyl)-4-oxobutanoyl]amino]-4-oxooctanamide |
| SMILES | CSCCC(CC=O)C(=O)NC(CC(C)C)C(=O)CC(Cc1ccccc1)C(=O)NCCCCC(N)C(C)=O |
| InChI | InChI=1S/C30H47N3O5S/c1-21(2)18-27(33-30(38)24(13-16-34)14-17-39-4)28(36)20-25(19-23-10-6-5-7-11-23)29(37)32-15-9-8-12-26(31)22(3)35/h5-7,10-11,16,21,24-27H,8-9,12-15,17-20,31H2,1-4H3,(H,32,37)(H,33,38) |
| InChIKey | QTKKJFQKXXKTPP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|