C14H27N3O3Si2 — CID 530214
trimethylsilyl 2-acetamido-3-(1-trimethylsilylimidazol-4-yl)propanoate (PubChem CID 530214) has the molecular formula C14H27N3O3Si2 and a molecular weight of 341.56 g/mol. Its IUPAC name is trimethylsilyl 2-acetamido-3-(1-trimethylsilylimidazol-4-yl)propanoate.
| Compound Name | trimethylsilyl 2-acetamido-3-(1-trimethylsilylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 530214 |
| Molecular Formula | C14H27N3O3Si2 |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | trimethylsilyl 2-acetamido-3-(1-trimethylsilylimidazol-4-yl)propanoate |
| SMILES | CC(=O)NC(Cc1cn([Si](C)(C)C)cn1)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H27N3O3Si2/c1-11(18)16-13(14(19)20-22(5,6)7)8-12-9-17(10-15-12)21(2,3)4/h9-10,13H,8H2,1-7H3,(H,16,18) |
| InChIKey | CYRMTJAGQABXKW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|