C20H24ClIN2O4 — CID 57379504
methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-iodo-4-phenylmethoxyphenyl)propanoate;hydrochloride (PubChem CID 57379504) has the molecular formula C20H24ClIN2O4 and a molecular weight of 518.78 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-iodo-4-phenylmethoxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-iodo-4-phenylmethoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 57379504 |
| Molecular Formula | C20H24ClIN2O4 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-iodo-4-phenylmethoxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)[C@H](Cc1ccc(OCc2ccccc2)c(I)c1)NC(=O)[C@H](C)N.Cl |
| InChI | InChI=1S/C20H23IN2O4.ClH/c1-13(22)19(24)23-17(20(25)26-2)11-15-8-9-18(16(21)10-15)27-12-14-6-4-3-5-7-14;/h3-10,13,17H,11-12,22H2,1-2H3,(H,23,24);1H/t13-,17-;/m0./s1 |
| InChIKey | KPJCQRDENBEBJT-KYLFUZKPSA-N |
| XLogP | 2.84 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|