C22H36IN3O5Si — CID 11017284
methyl (2S)-2-[[(2R)-2-[(2-aminoacetyl)-methylamino]-3-[4-[tert-butyl(dimethyl)silyl]oxy-3-iodophenyl]propanoyl]amino]propanoate (PubChem CID 11017284) has the molecular formula C22H36IN3O5Si and a molecular weight of 577.54 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-[(2-aminoacetyl)-methylamino]-3-[4-[tert-butyl(dimethyl)silyl]oxy-3-iodophenyl]propanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-[(2-aminoacetyl)-methylamino]-3-[4-[tert-butyl(dimethyl)silyl]oxy-3-iodophenyl]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 11017284 |
| Molecular Formula | C22H36IN3O5Si |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-[(2-aminoacetyl)-methylamino]-3-[4-[tert-butyl(dimethyl)silyl]oxy-3-iodophenyl]propanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@@H](Cc1ccc(O[Si](C)(C)C(C)(C)C)c(I)c1)N(C)C(=O)CN |
| InChI | InChI=1S/C22H36IN3O5Si/c1-14(21(29)30-6)25-20(28)17(26(5)19(27)13-24)12-15-9-10-18(16(23)11-15)31-32(7,8)22(2,3)4/h9-11,14,17H,12-13,24H2,1-8H3,(H,25,28)/t14-,17+/m0/s1 |
| InChIKey | RJKUOWMSLVPLCB-WMLDXEAASA-N |
| XLogP | 2.68 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|