C11H11I2NO4 — CID 54553136
(2S)-3-(4-hydroxy-3-iodophenyl)-2-[(2-iodoacetyl)amino]propanoic acid (PubChem CID 54553136) has the molecular formula C11H11I2NO4 and a molecular weight of 475.02 g/mol. Its IUPAC name is (2S)-3-(4-hydroxy-3-iodophenyl)-2-[(2-iodoacetyl)amino]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxy-3-iodophenyl)-2-[(2-iodoacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 54553136 |
| Molecular Formula | C11H11I2NO4 |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.88 |
| IUPAC Name | (2S)-3-(4-hydroxy-3-iodophenyl)-2-[(2-iodoacetyl)amino]propanoic acid |
| SMILES | O=C(CI)N[C@@H](Cc1ccc(O)c(I)c1)C(=O)O |
| InChI | InChI=1S/C11H11I2NO4/c12-5-10(16)14-8(11(17)18)4-6-1-2-9(15)7(13)3-6/h1-3,8,15H,4-5H2,(H,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | ZLHGMGDCMSYZTR-QMMMGPOBSA-N |
| XLogP | 1.54 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|