C16H24O2 — CID 116931289
methyl 2-[(2,3,5,6-tetramethylphenyl)methyl]butanoate (PubChem CID 116931289) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is methyl 2-[(2,3,5,6-tetramethylphenyl)methyl]butanoate.
| Compound Name | methyl 2-[(2,3,5,6-tetramethylphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 116931289 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | methyl 2-[(2,3,5,6-tetramethylphenyl)methyl]butanoate |
| SMILES | CCC(Cc1c(C)c(C)cc(C)c1C)C(=O)OC |
| InChI | InChI=1S/C16H24O2/c1-7-14(16(17)18-6)9-15-12(4)10(2)8-11(3)13(15)5/h8,14H,7,9H2,1-6H3 |
| InChIKey | WSHGFJCNEDEXBB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |