C15H26O5Si2 — CID 629939
trimethylsilyl 3,5-dimethoxy-4-trimethylsilyloxybenzoate (PubChem CID 629939) has the molecular formula C15H26O5Si2 and a molecular weight of 342.54 g/mol. Its IUPAC name is trimethylsilyl 3,5-dimethoxy-4-trimethylsilyloxybenzoate.
| Compound Name | trimethylsilyl 3,5-dimethoxy-4-trimethylsilyloxybenzoate |
|---|---|
| PubChem CID | 629939 |
| Molecular Formula | C15H26O5Si2 |
| Molecular Weight | 342.54 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | trimethylsilyl 3,5-dimethoxy-4-trimethylsilyloxybenzoate |
| SMILES | COc1cc(C(=O)O[Si](C)(C)C)cc(OC)c1O[Si](C)(C)C |
| InChI | InChI=1S/C15H26O5Si2/c1-17-12-9-11(15(16)20-22(6,7)8)10-13(18-2)14(12)19-21(3,4)5/h9-10H,1-8H3 |
| InChIKey | KWOFGVXBWXVAJU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|