C17H30O6Si2 — CID 622785
trimethylsilyl 2-(3,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetate (PubChem CID 622785) has the molecular formula C17H30O6Si2 and a molecular weight of 386.59 g/mol. Its IUPAC name is trimethylsilyl 2-(3,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetate.
| Compound Name | trimethylsilyl 2-(3,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetate |
|---|---|
| PubChem CID | 622785 |
| Molecular Formula | C17H30O6Si2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | trimethylsilyl 2-(3,4,5-trimethoxyphenyl)-2-trimethylsilyloxyacetate |
| SMILES | COc1cc(C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H30O6Si2/c1-19-13-10-12(11-14(20-2)16(13)21-3)15(22-24(4,5)6)17(18)23-25(7,8)9/h10-11,15H,1-9H3 |
| InChIKey | URQQYPNDLURSKC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|