C12H15N3O4 — CID 43559200
1,2,4-oxadiazol-3-yl-(3,4,5-trimethoxyphenyl)methanamine (PubChem CID 43559200) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1,2,4-oxadiazol-3-yl-(3,4,5-trimethoxyphenyl)methanamine.
| Compound Name | 1,2,4-oxadiazol-3-yl-(3,4,5-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43559200 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1,2,4-oxadiazol-3-yl-(3,4,5-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(C(N)c2ncon2)cc(OC)c1OC |
| InChI | InChI=1S/C12H15N3O4/c1-16-8-4-7(5-9(17-2)11(8)18-3)10(13)12-14-6-19-15-12/h4-6,10H,13H2,1-3H3 |
| InChIKey | JCGDRPQYWYYOGB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |