C21H19I3O7S — CID 177131914
2,6-diiodo-4-[2-[1-[2-(4-iodophenoxy)-2-oxoethyl]cyclopentyl]acetyl]oxybenzenesulfonic acid (PubChem CID 177131914) has the molecular formula C21H19I3O7S and a molecular weight of 796.15 g/mol. Its IUPAC name is 2,6-diiodo-4-[2-[1-[2-(4-iodophenoxy)-2-oxoethyl]cyclopentyl]acetyl]oxybenzenesulfonic acid.
| Compound Name | 2,6-diiodo-4-[2-[1-[2-(4-iodophenoxy)-2-oxoethyl]cyclopentyl]acetyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177131914 |
| Molecular Formula | C21H19I3O7S |
| Molecular Weight | 796.15 g/mol |
| Exact Mass | 795.80 |
| IUPAC Name | 2,6-diiodo-4-[2-[1-[2-(4-iodophenoxy)-2-oxoethyl]cyclopentyl]acetyl]oxybenzenesulfonic acid |
| SMILES | O=C(CC1(CC(=O)Oc2cc(I)c(S(=O)(=O)O)c(I)c2)CCCC1)Oc1ccc(I)cc1 |
| InChI | InChI=1S/C21H19I3O7S/c22-13-3-5-14(6-4-13)30-18(25)11-21(7-1-2-8-21)12-19(26)31-15-9-16(23)20(17(24)10-15)32(27,28)29/h3-6,9-10H,1-2,7-8,11-12H2,(H,27,28,29) |
| InChIKey | FZEYWSKNAFDCIX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.15 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|