C13H3Br2F4O6S- — CID 156666423
4-(3,5-dibromo-2-hydroxybenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 156666423) has the molecular formula C13H3Br2F4O6S- and a molecular weight of 523.03 g/mol. Its IUPAC name is 4-(3,5-dibromo-2-hydroxybenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(3,5-dibromo-2-hydroxybenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 156666423 |
| Molecular Formula | C13H3Br2F4O6S- |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 520.80 |
| IUPAC Name | 4-(3,5-dibromo-2-hydroxybenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C13H4Br2F4O6S/c14-3-1-4(10(20)5(15)2-3)13(21)25-11-6(16)8(18)12(26(22,23)24)9(19)7(11)17/h1-2,20H,(H,22,23,24)/p-1 |
| InChIKey | PFJSLNLSJPQSFX-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|