C15H9F4IO6S — CID 176596866
2,3,5,6-tetrafluoro-4-[2-(4-iodobenzoyl)oxyethoxy]benzenesulfonic acid (PubChem CID 176596866) has the molecular formula C15H9F4IO6S and a molecular weight of 520.19 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2-(4-iodobenzoyl)oxyethoxy]benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2-(4-iodobenzoyl)oxyethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 176596866 |
| Molecular Formula | C15H9F4IO6S |
| Molecular Weight | 520.19 g/mol |
| Exact Mass | 519.91 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2-(4-iodobenzoyl)oxyethoxy]benzenesulfonic acid |
| SMILES | O=C(OCCOc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H9F4IO6S/c16-9-11(18)14(27(22,23)24)12(19)10(17)13(9)25-5-6-26-15(21)7-1-3-8(20)4-2-7/h1-4H,5-6H2,(H,22,23,24) |
| InChIKey | IQXDVYHDWMGWJN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|