C19H15BrF4O7S — CID 176607340
4-[4-bromo-3-(2,2-dimethylbutanoyloxy)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 176607340) has the molecular formula C19H15BrF4O7S and a molecular weight of 543.29 g/mol. Its IUPAC name is 4-[4-bromo-3-(2,2-dimethylbutanoyloxy)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[4-bromo-3-(2,2-dimethylbutanoyloxy)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 176607340 |
| Molecular Formula | C19H15BrF4O7S |
| Molecular Weight | 543.29 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 4-[4-bromo-3-(2,2-dimethylbutanoyloxy)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)(C)C(=O)Oc1cc(C(=O)Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)ccc1Br |
| InChI | InChI=1S/C19H15BrF4O7S/c1-4-19(2,3)18(26)30-10-7-8(5-6-9(10)20)17(25)31-15-11(21)13(23)16(32(27,28)29)14(24)12(15)22/h5-7H,4H2,1-3H3,(H,27,28,29) |
| InChIKey | XHOJKRXVWASSFG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|