C40H26F3IO9S2 — CID 176880068
4-[16-[2-(4-iodophenyl)sulfonyloxyphenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxy-2-(trifluoromethoxy)naphthalene-1-sulfonic acid (PubChem CID 176880068) has the molecular formula C40H26F3IO9S2 and a molecular weight of 898.67 g/mol. Its IUPAC name is 4-[16-[2-(4-iodophenyl)sulfonyloxyphenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxy-2-(trifluoromethoxy)naphthalene-1-sulfonic acid.
| Compound Name | 4-[16-[2-(4-iodophenyl)sulfonyloxyphenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxy-2-(trifluoromethoxy)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 176880068 |
| Molecular Formula | C40H26F3IO9S2 |
| Molecular Weight | 898.67 g/mol |
| Exact Mass | 898.00 |
| IUPAC Name | 4-[16-[2-(4-iodophenyl)sulfonyloxyphenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxy-2-(trifluoromethoxy)naphthalene-1-sulfonic acid |
| SMILES | O=C(Oc1cc(OC(F)(F)F)c(S(=O)(=O)O)c2ccccc12)C1C2c3ccccc3C(c3ccccc32)C1c1ccccc1OS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C40H26F3IO9S2/c41-40(42,43)52-33-21-32(24-9-1-6-14-29(24)38(33)54(46,47)48)51-39(45)37-35-27-12-4-2-10-25(27)34(26-11-3-5-13-28(26)35)36(37)30-15-7-8-16-31(30)53-55(49,50)23-19-17-22(44)18-20-23/h1-21,34-37H,(H,46,47,48) |
| InChIKey | ACKBJAWOQMZRDI-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.67 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|