C33H28F17O10S2+ — CID 163920338
[2,4-bis[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-[4-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium (PubChem CID 163920338) has the molecular formula C33H28F17O10S2+ and a molecular weight of 971.68 g/mol. Its IUPAC name is [2,4-bis[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-[4-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium.
| Compound Name | [2,4-bis[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-[4-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 163920338 |
| Molecular Formula | C33H28F17O10S2+ |
| Molecular Weight | 971.68 g/mol |
| Exact Mass | 971.08 |
| IUPAC Name | [2,4-bis[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-[4-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium |
| SMILES | COCOC(COc1ccc([S+](c2ccccc2)c2ccc(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)cc2)c(OCC(OCOC)(C(F)(F)F)C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C33H27F17O10S2/c1-54-17-58-26(30(39,40)41,31(42,43)44)15-56-20-10-13-24(23(14-20)57-16-27(32(45,46)47,33(48,49)50)59-18-55-2)61(21-6-4-3-5-7-21)22-11-8-19(9-12-22)60-25(28(34,35)36)29(37,38)62(51,52)53/h3-14,25H,15-18H2,1-2H3/p+1 |
| InChIKey | QZWVUFABUVWAQF-UHFFFAOYSA-O |
| XLogP | 9.30 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.68 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|