C27H25F8O7S2+ — CID 140846986
[4-(2,2-difluoro-2-sulfoethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(1-methoxyethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium (PubChem CID 140846986) has the molecular formula C27H25F8O7S2+ and a molecular weight of 677.61 g/mol. Its IUPAC name is [4-(2,2-difluoro-2-sulfoethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(1-methoxyethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium.
| Compound Name | [4-(2,2-difluoro-2-sulfoethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(1-methoxyethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140846986 |
| Molecular Formula | C27H25F8O7S2+ |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 677.09 |
| IUPAC Name | [4-(2,2-difluoro-2-sulfoethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(1-methoxyethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
| SMILES | COC(C)OC(COc1ccc([S+](c2ccccc2)c2ccc(OCC(F)(F)S(=O)(=O)O)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H24F8O7S2/c1-18(39-2)42-24(26(30,31)32,27(33,34)35)16-40-19-8-12-22(13-9-19)43(21-6-4-3-5-7-21)23-14-10-20(11-15-23)41-17-25(28,29)44(36,37)38/h3-15,18H,16-17H2,1-2H3/p+1 |
| InChIKey | DPFDNQCBGLGJOA-UHFFFAOYSA-O |
| XLogP | 6.89 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|