C27H27F6O5S+ — CID 140916010
[4-(2-methoxyethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium (PubChem CID 140916010) has the molecular formula C27H27F6O5S+ and a molecular weight of 577.56 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium.
| Compound Name | [4-(2-methoxyethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140916010 |
| Molecular Formula | C27H27F6O5S+ |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | [4-(2-methoxyethoxy)phenyl]-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
| SMILES | COCCOc1ccc([S+](c2ccccc2)c2ccc(OCC(OCOC)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H27F6O5S/c1-34-16-17-36-20-8-12-23(13-9-20)39(22-6-4-3-5-7-22)24-14-10-21(11-15-24)37-18-25(26(28,29)30,27(31,32)33)38-19-35-2/h3-15H,16-19H2,1-2H3/q+1 |
| InChIKey | MDWZEGHLKGAAIC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|