C24H24F3O2S+ — CID 161025552
[4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-diphenylsulfanium (PubChem CID 161025552) has the molecular formula C24H24F3O2S+ and a molecular weight of 433.52 g/mol. Its IUPAC name is [4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-diphenylsulfanium.
| Compound Name | [4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 161025552 |
| Molecular Formula | C24H24F3O2S+ |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-diphenylsulfanium |
| SMILES | CCOC(C)(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H24F3O2S/c1-3-29-23(2,24(25,26)27)18-28-19-14-16-22(17-15-19)30(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,3,18H2,1-2H3/q+1 |
| InChIKey | AXPDMZVPBYCOLZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|