C25H25F6O2SSi+ — CID 140915980
diphenyl-[4-[3,3,3-trifluoro-2-(trifluoromethyl)-2-trimethylsilyloxypropoxy]phenyl]sulfanium (PubChem CID 140915980) has the molecular formula C25H25F6O2SSi+ and a molecular weight of 531.61 g/mol. Its IUPAC name is diphenyl-[4-[3,3,3-trifluoro-2-(trifluoromethyl)-2-trimethylsilyloxypropoxy]phenyl]sulfanium.
| Compound Name | diphenyl-[4-[3,3,3-trifluoro-2-(trifluoromethyl)-2-trimethylsilyloxypropoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140915980 |
| Molecular Formula | C25H25F6O2SSi+ |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | diphenyl-[4-[3,3,3-trifluoro-2-(trifluoromethyl)-2-trimethylsilyloxypropoxy]phenyl]sulfanium |
| SMILES | C[Si](C)(C)OC(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H25F6O2SSi/c1-35(2,3)33-23(24(26,27)28,25(29,30)31)18-32-19-14-16-22(17-15-19)34(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,18H2,1-3H3/q+1 |
| InChIKey | NJPNNLQUYHSZIT-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|