C23H17F8OS+ — CID 176874101
[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-diphenylsulfanium (PubChem CID 176874101) has the molecular formula C23H17F8OS+ and a molecular weight of 493.44 g/mol. Its IUPAC name is [4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-diphenylsulfanium.
| Compound Name | [4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 176874101 |
| Molecular Formula | C23H17F8OS+ |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | [4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-diphenylsulfanium |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17F8OS/c24-20(25)22(28,29)23(30,31)21(26,27)15-32-16-11-13-19(14-12-16)33(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,20H,15H2/q+1 |
| InChIKey | KDPDACLPWWKKLD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|