C22H19F2O6S2+ — CID 154594595
[4-[2-(2,2-difluoro-2-sulfoethoxy)-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 154594595) has the molecular formula C22H19F2O6S2+ and a molecular weight of 481.52 g/mol. Its IUPAC name is [4-[2-(2,2-difluoro-2-sulfoethoxy)-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(2,2-difluoro-2-sulfoethoxy)-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 154594595 |
| Molecular Formula | C22H19F2O6S2+ |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | [4-[2-(2,2-difluoro-2-sulfoethoxy)-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | O=C(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C22H18F2O6S2/c23-22(24,32(26,27)28)16-30-21(25)15-29-17-11-13-20(14-12-17)31(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14H,15-16H2/p+1 |
| InChIKey | ZEFUKCQYSXRSRV-UHFFFAOYSA-O |
| XLogP | 4.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|