C31H23F2O6S2+ — CID 154594642
[4-[5-(2,2-difluoro-2-sulfoethoxy)carbonylnaphthalen-1-yl]oxyphenyl]-diphenylsulfanium (PubChem CID 154594642) has the molecular formula C31H23F2O6S2+ and a molecular weight of 593.65 g/mol. Its IUPAC name is [4-[5-(2,2-difluoro-2-sulfoethoxy)carbonylnaphthalen-1-yl]oxyphenyl]-diphenylsulfanium.
| Compound Name | [4-[5-(2,2-difluoro-2-sulfoethoxy)carbonylnaphthalen-1-yl]oxyphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 154594642 |
| Molecular Formula | C31H23F2O6S2+ |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | [4-[5-(2,2-difluoro-2-sulfoethoxy)carbonylnaphthalen-1-yl]oxyphenyl]-diphenylsulfanium |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1cccc2c(Oc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cccc12 |
| InChI | InChI=1S/C31H22F2O6S2/c32-31(33,41(35,36)37)21-38-30(34)28-15-7-14-27-26(28)13-8-16-29(27)39-22-17-19-25(20-18-22)40(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-20H,21H2/p+1 |
| InChIKey | TVAFPSULTZJDLY-UHFFFAOYSA-O |
| XLogP | 7.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|