C32H26F2O5S2 — CID 87386657
benzhydrylsulfanylbenzene;1,1-difluoro-2-(naphthalene-1-carbonyloxy)ethanesulfonic acid (PubChem CID 87386657) has the molecular formula C32H26F2O5S2 and a molecular weight of 592.69 g/mol. Its IUPAC name is benzhydrylsulfanylbenzene;1,1-difluoro-2-(naphthalene-1-carbonyloxy)ethanesulfonic acid.
| Compound Name | benzhydrylsulfanylbenzene;1,1-difluoro-2-(naphthalene-1-carbonyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 87386657 |
| Molecular Formula | C32H26F2O5S2 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | benzhydrylsulfanylbenzene;1,1-difluoro-2-(naphthalene-1-carbonyloxy)ethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1cccc2ccccc12.c1ccc(SC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16S.C13H10F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;14-13(15,21(17,18)19)8-20-12(16)11-7-3-5-9-4-1-2-6-10(9)11/h1-15,19H;1-7H,8H2,(H,17,18,19) |
| InChIKey | QRUWYIMIQMDSPE-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|