C25H26F3O2S+ — CID 159209585
[4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-(4-methylphenyl)-phenylsulfanium (PubChem CID 159209585) has the molecular formula C25H26F3O2S+ and a molecular weight of 447.54 g/mol. Its IUPAC name is [4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-(4-methylphenyl)-phenylsulfanium.
| Compound Name | [4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-(4-methylphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 159209585 |
| Molecular Formula | C25H26F3O2S+ |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [4-(2-ethoxy-3,3,3-trifluoro-2-methylpropoxy)phenyl]-(4-methylphenyl)-phenylsulfanium |
| SMILES | CCOC(C)(COc1ccc([S+](c2ccccc2)c2ccc(C)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H26F3O2S/c1-4-30-24(3,25(26,27)28)18-29-20-12-16-23(17-13-20)31(21-8-6-5-7-9-21)22-14-10-19(2)11-15-22/h5-17H,4,18H2,1-3H3/q+1 |
| InChIKey | LUPUZSRZNARYCQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|