C31H31F2O7S2+ — CID 160744196
2-[2,6-bis(methoxymethyl)-4-methylphenoxy]-1,1-difluoro-2-oxoethanesulfonic acid;triphenylsulfanium (PubChem CID 160744196) has the molecular formula C31H31F2O7S2+ and a molecular weight of 617.71 g/mol. Its IUPAC name is 2-[2,6-bis(methoxymethyl)-4-methylphenoxy]-1,1-difluoro-2-oxoethanesulfonic acid;triphenylsulfanium.
| Compound Name | 2-[2,6-bis(methoxymethyl)-4-methylphenoxy]-1,1-difluoro-2-oxoethanesulfonic acid;triphenylsulfanium |
|---|---|
| PubChem CID | 160744196 |
| Molecular Formula | C31H31F2O7S2+ |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 2-[2,6-bis(methoxymethyl)-4-methylphenoxy]-1,1-difluoro-2-oxoethanesulfonic acid;triphenylsulfanium |
| SMILES | COCc1cc(C)cc(COC)c1OC(=O)C(F)(F)S(=O)(=O)O.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H16F2O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8-4-9(6-20-2)11(10(5-8)7-21-3)22-12(16)13(14,15)23(17,18)19/h1-15H;4-5H,6-7H2,1-3H3,(H,17,18,19)/q+1; |
| InChIKey | RVZDCLUUKKAWKI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|