C18H16F2O7S — CID 159370302
1,1-difluoro-2-oxo-2-[4-(2,3,5-trimethylbenzoyl)oxyphenoxy]ethanesulfonic acid (PubChem CID 159370302) has the molecular formula C18H16F2O7S and a molecular weight of 414.38 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[4-(2,3,5-trimethylbenzoyl)oxyphenoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[4-(2,3,5-trimethylbenzoyl)oxyphenoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 159370302 |
| Molecular Formula | C18H16F2O7S |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[4-(2,3,5-trimethylbenzoyl)oxyphenoxy]ethanesulfonic acid |
| SMILES | Cc1cc(C)c(C)c(C(=O)Oc2ccc(OC(=O)C(F)(F)S(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C18H16F2O7S/c1-10-8-11(2)12(3)15(9-10)16(21)26-13-4-6-14(7-5-13)27-17(22)18(19,20)28(23,24)25/h4-9H,1-3H3,(H,23,24,25) |
| InChIKey | IAHPFKATPVZGPU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|