C15H11F2IO6S — CID 167060607
1,1-difluoro-2-[4-(4-iodo-2-methylphenoxy)phenoxy]-2-oxoethanesulfonic acid (PubChem CID 167060607) has the molecular formula C15H11F2IO6S and a molecular weight of 484.21 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-(4-iodo-2-methylphenoxy)phenoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-(4-iodo-2-methylphenoxy)phenoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167060607 |
| Molecular Formula | C15H11F2IO6S |
| Molecular Weight | 484.21 g/mol |
| Exact Mass | 483.93 |
| IUPAC Name | 1,1-difluoro-2-[4-(4-iodo-2-methylphenoxy)phenoxy]-2-oxoethanesulfonic acid |
| SMILES | Cc1cc(I)ccc1Oc1ccc(OC(=O)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H11F2IO6S/c1-9-8-10(18)2-7-13(9)23-11-3-5-12(6-4-11)24-14(19)15(16,17)25(20,21)22/h2-8H,1H3,(H,20,21,22) |
| InChIKey | QTYUONUNTUSEGH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|