C12H7F2NO7S — CID 167356447
2-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 167356447) has the molecular formula C12H7F2NO7S and a molecular weight of 347.25 g/mol. Its IUPAC name is 2-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167356447 |
| Molecular Formula | C12H7F2NO7S |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 2-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C1C=CC(=O)N1c1ccc(OC(=O)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H7F2NO7S/c13-12(14,23(19,20)21)11(18)22-8-3-1-7(2-4-8)15-9(16)5-6-10(15)17/h1-6H,(H,19,20,21) |
| InChIKey | WEOGCJFGYNVKAG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|