C16H13NO8 — CID 172764746
(Z)-but-2-enedioic acid;[4-(2,5-dioxopyrrol-1-yl)phenyl] acetate (PubChem CID 172764746) has the molecular formula C16H13NO8 and a molecular weight of 347.28 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;[4-(2,5-dioxopyrrol-1-yl)phenyl] acetate.
| Compound Name | (Z)-but-2-enedioic acid;[4-(2,5-dioxopyrrol-1-yl)phenyl] acetate |
|---|---|
| PubChem CID | 172764746 |
| Molecular Formula | C16H13NO8 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (Z)-but-2-enedioic acid;[4-(2,5-dioxopyrrol-1-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C=CC2=O)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H9NO4.C4H4O4/c1-8(14)17-10-4-2-9(3-5-10)13-11(15)6-7-12(13)16;5-3(6)1-2-4(7)8/h2-7H,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | MDUCHRACZXKORC-BTJKTKAUSA-N |
| XLogP | 0.75 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|